CAS 2170-50-5
:N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-3-phenoxypropan-1-amine
Description:
N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-3-phenoxypropan-1-amine, with the CAS number 2170-50-5, is a chemical compound that features a complex structure characterized by a benzodioxin moiety and a phenoxypropanamine framework. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It may possess moderate to high lipophilicity due to the presence of aromatic rings, which can influence its solubility and permeability in biological systems. The amine functional group suggests potential for hydrogen bonding and reactivity, which may be relevant in pharmacological contexts. Additionally, the compound's structural features may allow for interactions with various biological targets, making it of interest in medicinal chemistry. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise evaluation. Overall, this compound's unique structure positions it as a candidate for further investigation in drug development and related fields.
Formula:C18H21NO3
InChI:InChI=1/C18H21NO3/c1-2-7-15(8-3-1)20-12-6-11-19-13-16-14-21-17-9-4-5-10-18(17)22-16/h1-5,7-10,16,19H,6,11-14H2
Synonyms:- 2,3-Dihydro-N-(3-phenoxypropyl)-1,4-benzodioxin-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
