CymitQuimica logo

CAS 21704-46-1

:

Carbamimidothioic acid, ethyl ester, diethyl phosphate (1:1)

Description:
Carbamimidothioic acid, ethyl ester, diethyl phosphate (1:1), with the CAS number 21704-46-1, is a chemical compound that features a unique combination of functional groups, including a carbamimidothioic acid moiety and a diethyl phosphate group. This compound is characterized by its potential use in various chemical applications, particularly in the fields of agriculture and pharmaceuticals, due to its ability to act as a bioactive agent. The presence of the carbamimidothioic acid structure suggests that it may exhibit properties related to thiol reactivity, while the diethyl phosphate component can impart characteristics associated with phosphoric acid derivatives, such as solubility in polar solvents and potential interactions with biological systems. The compound's molecular structure allows for various chemical reactions, making it a subject of interest for synthetic chemistry. Additionally, its safety and handling require careful consideration, as with many organophosphate compounds, due to potential toxicity and environmental impact. Overall, this compound represents a fascinating intersection of organic and inorganic chemistry with practical applications.
Formula:C4H11O4P·C3H8N2S
InChI:InChI=1S/C4H11O4P.C3H8N2S/c1-3-7-9(5,6)8-4-2;1-2-6-3(4)5/h3-4H2,1-2H3,(H,5,6);2H2,1H3,(H3,4,5)
InChI key:InChIKey=CSYSULGPHGCBQD-UHFFFAOYSA-N
SMILES:S(C(=N)N)CC.P(OCC)(OCC)(=O)O
Synonyms:
  • Carbamimidothioic acid, ethyl ester, diethyl phosphate (1:1)
  • Pseudourea, 2-ethyl-2-thio-, compd. with ethyl phosphate
  • Phosphoric acid, diethyl ester, compd. with 2-ethyl-2-thiopseudourea (1:1)
  • Pseudourea, 2-ethyl-2-thio-, mono(diethyl phosphate)
  • Carbamimidothioic acid, ethyl ester, mono(diethyl phosphate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.