CAS 217073-76-2
:1-(4-fluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid
Description:
1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the para position, contributing to the compound's unique electronic properties. The methyl group at the 5-position of the pyrazole ring adds to its hydrophobic character, while the carboxylic acid functional group at the 4-position introduces acidity and potential for hydrogen bonding. This compound is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and analgesic properties. Its structural features may influence its solubility, stability, and reactivity, making it a candidate for further pharmacological studies. Additionally, the presence of the fluorine atom can enhance metabolic stability and bioavailability, which are critical factors in drug development. Overall, this compound exemplifies the complexity and versatility of pyrazole derivatives in chemical and pharmaceutical research.
Formula:C11H9FN2O2
InChI:InChI=1/C11H9FN2O2/c1-7-10(11(15)16)6-13-14(7)9-4-2-8(12)3-5-9/h2-6H,1H3,(H,15,16)
SMILES:Cc1c(cnn1c1ccc(cc1)F)C(=O)O
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 1-(4-fluorophenyl)-5-methyl-
- 1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(4-fluorophenyl)-5-methylpyrazole-4-carboxylic acid
CAS:Formula:C11H9FN2O2Purity:98%Color and Shape:SolidMolecular weight:220.19981-(4-Fluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid
CAS:1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid
Formula:C11H9FN2O2Purity:95%Color and Shape: white solidMolecular weight:220.20g/mol1-(4-Fluoro-phenyl)-5-methyl-1H-pyrazole-4-carboxylic acid
CAS:Formula:C11H9FN2O2Purity:95%Color and Shape:White powderMolecular weight:220.2031-(4-Fluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid
CAS:Please enquire for more information about 1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H9FN2O2Purity:Min. 95%Molecular weight:220.2 g/mol



