CAS 217099-43-9

2-carbamimidoyl-1-benzothiophen-6-yl thiophene-2-carboxylate

Description:

2-Carbamimidoyl-1-benzothiophen-6-yl thiophene-2-carboxylate, with the CAS number 217099-43-9, is a chemical compound that features a complex structure incorporating both thiophene and benzothiophene moieties. This compound is characterized by the presence of a carbamimidoyl group, which contributes to its potential biological activity, particularly in medicinal chemistry. The thiophene-2-carboxylate part of the molecule suggests that it may exhibit properties related to carboxylic acids, such as acidity and reactivity with various nucleophiles. The benzothiophene component adds to the compound's aromatic character, potentially influencing its electronic properties and solubility. Overall, this compound may be of interest in research areas such as drug development, where its unique structural features could lead to novel therapeutic applications. Its specific physical and chemical properties, such as solubility, melting point, and reactivity, would need to be determined through experimental methods for practical applications.

Formula: C₁₄H₁₀N₂O₂S₂

InChI: InChI=1/C14H10N2O2S2/c15-13(16)12-6-8-3-4-9(7-11(8)20-12)18-14(17)10-2-1-5-19-10/h1-7H,(H3,15,16)

SMILES: c1cc(C(=O)Oc2ccc3cc(C(=N)N)sc3c2)sc1

Synonyms:

• 2-Carbamimidoyl-1-benzothiophen-6-ylthiophen-2-carboxylat

BCX 1470

CAS: 217099-43-9

BCX 1470 inhibits the esterolytic activity of factor D and C1s (IC50: 96 nM and 1.6 nM), 3.4- and 200-fold better than that of trypsin, respectively.

Formula: C₁₄H₁₀N₂O₂S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 302.37

Ref: TM-T13568