CAS 217190-15-3
:Bodipy Tmr-X
Description:
Bodipy Tmr-X, with the CAS number 217190-15-3, is a fluorescent dye known for its vibrant red emission and high photostability, making it a valuable tool in various biological and chemical applications. This compound belongs to the boron-dipyrromethene (BODIPY) family, which is characterized by its unique structure that includes a boron atom coordinated to a dipyrromethene moiety. Bodipy Tmr-X exhibits excellent solubility in organic solvents and is relatively stable under a range of pH conditions, which enhances its utility in fluorescence microscopy and flow cytometry. Its strong absorption and emission properties allow for effective labeling and tracking of biomolecules in live cells. Additionally, the compound's low toxicity and high quantum yield contribute to its popularity in research, particularly in studies involving cellular imaging and diagnostics. Overall, Bodipy Tmr-X is a versatile and efficient fluorescent probe widely used in scientific research.
Formula:C31H35BF2N4O6
InChI:InChI=1S/C31H35BF2N4O6/c1-20-25(13-15-28(39)35-18-6-4-5-7-31(42)44-38-29(40)16-17-30(38)41)21(2)36-27(20)19-23-10-14-26(37(23)32(36,33)34)22-8-11-24(43-3)12-9-22/h8-12,14,19H,4-7,13,15-18H2,1-3H3,(H,35,39)
InChI key:InChIKey=GRDQURHVJJVDRY-UHFFFAOYSA-N
SMILES:[F-][B+3]1([F-])[N]=2C(=CC=3[N-]1C(C)=C(CCC(NCCCCCC(ON4C(=O)CCC4=O)=O)=O)C3C)C=CC2C5=CC=C(OC)C=C5
Synonyms:- (T-4)-[N-[6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-5-[[5-(4-methoxyphenyl)-2H-pyrrol-2-ylidene-κN]methyl]-2,4-dimethyl-1H-pyrrole-3-propanamidato-κN1]difluoroboron
- BDY TMR-X, SE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(T-4)-[N-[6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-5-[[5-(4-methoxyphenyl)-2H-pyrrol-2-ylidene-κN]methyl]-2,4-dimethyl-1H-pyrrole-3-propanamidato-κN1]difluoroboron
CAS:Formula:C31H35BF2N4O6Molecular weight:608.4406BODIPY TMR-X SE
CAS:BODIPY TMR-X SE is a potent fluorescent dye that labels primary amines (R-NH2) in proteins, amine-modified oligonucleotides, and other amine-containingFormula:C31H35BF2N4O6Color and Shape:SolidMolecular weight:608.44BDY TMR-X, SE
CAS:Controlled ProductFormula:C31H35BF2N4O6Color and Shape:NeatMolecular weight:608.441


