CymitQuimica logo

CAS 2172559-92-9

:

Methyl 2-(5-acetylpyridin-2-yl)propanoate

Description:
Methyl 2-(5-acetylpyridin-2-yl)propanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a pyridine ring substituted with an acetyl group at the 5-position and a propanoate moiety, contributing to its unique chemical properties. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the acetyl group can participate in various chemical reactions, including nucleophilic attacks. Methyl 2-(5-acetylpyridin-2-yl)propanoate is likely to be a polar molecule due to the electronegative nitrogen in the pyridine ring and the carbonyl group in the acetyl moiety, influencing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves standard organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c1-7(11(14)15-3)10-5-4-9(6-12-10)8(2)13/h4-7H,1-3H3
InChI key:DSJWUFMOQUFMAR-UHFFFAOYSA-N
SMILES:CC(C1=NC=C(C=C1)C(=O)C)C(=O)OC
Synonyms:
  • Methyl 2-(5-acetylpyridin-2-yl)propanoate
  • 2-Pyridineacetic acid, 5-acetyl-α-methyl-, methyl ester
Found 2 products.