CAS 217300-17-9

(chloromethoxy)(tripropan-2-yl)silane

Description:

The chemical substance known as (chloromethoxy)(tripropan-2-yl)silane, with the CAS number 217300-17-9, is an organosilicon compound characterized by the presence of both chloromethoxy and isopropyl groups attached to a silicon atom. This compound typically exhibits properties associated with silanes, such as reactivity with moisture, which can lead to hydrolysis and the formation of silanol groups. It is likely to be a colorless to pale yellow liquid, with a distinctive odor, and may have moderate volatility. The presence of the chloromethoxy group suggests potential applications in organic synthesis and as a coupling agent, while the isopropyl groups may enhance its hydrophobic characteristics. Additionally, this compound may be used in surface modification, adhesion promotion, or as a precursor in the synthesis of more complex silane derivatives. Safety considerations should be taken into account, as it may be harmful if inhaled or ingested, and appropriate handling procedures should be followed to mitigate exposure risks.

Formula: C₁₀H₂₃ClOSi

InChI: InChI=1/C10H23ClOSi/c1-8(2)13(9(3)4,10(5)6)12-7-11/h8-10H,7H2,1-6H3

SMILES: CC(C)[Si](C(C)C)(C(C)C)OCCl

(Chloromethoxy)tris(1-methylethyl)silane

CAS: 217300-17-9

Formula: C₁₀H₂₃ClOSi

Purity: 98%

Color and Shape: Liquid

Molecular weight: 222.8275

Ref: IN-DA0037TV

(Triisopropylsiloxy)methyl chloride

CAS: 217300-17-9

(Triisopropylsiloxy)methyl chloride

Purity: 85%

Molecular weight: 222.83g/mol

Ref: 54-OR1001896

(Triisopropylsiloxy)methyl chloride

CAS: 217300-17-9

Fluoride-labile 2′-O-protecting group for RNA oligonucleotide synthesis

Formula: C₁₀H₂₃ClOSi

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 222.83 g/mol

Ref: 3D-FT168042

(Triisopropylsiloxy)methyl chloride

CAS: 217300-17-9

Purity: 95%

Color and Shape: Liquid

Molecular weight: 222.8300018

Ref: 10-F626884