CAS 217313-79-6

{amino[4-(ammoniomethyl)phenyl]methylidene}ammonium

Description:

The chemical substance known as {amino[4-(ammoniomethyl)phenyl]methylidene}ammonium, with the CAS number 217313-79-6, is characterized by its complex structure that includes multiple functional groups, notably amino and ammonium groups. This compound is likely to exhibit properties typical of ammonium salts, such as solubility in water and the ability to form hydrogen bonds due to the presence of amino groups. Its structure suggests potential applications in fields such as pharmaceuticals or materials science, where its reactivity and ability to interact with other molecules could be advantageous. The presence of the phenyl group may also impart aromatic characteristics, influencing its stability and reactivity. Additionally, the compound's ionic nature may affect its physical properties, such as melting point and conductivity in solution. Overall, this substance represents a unique combination of organic functional groups that could lead to diverse applications depending on its specific interactions and behavior in various environments.

Formula: C₈H₁₃N₃

InChI: InChI=1/C8H11N3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5,9H2,(H3,10,11)/p+2

4-AMINOMETHYL BENZAMIDINE DIHYDROCHLORIDE

CAS: 217313-79-6

Formula: C₈H₁₃Cl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.1149

Ref: IN-DA00BDFK

4-(Aminomethyl)benzimidamidedihydrochloride

CAS: 217313-79-6

4-(Aminomethyl)benzimidamidedihydrochloride

Purity: 98%

Molecular weight: 222.12g/mol

Ref: 54-OR1005522

4-Aminomethyl Benzamidine Dihydrochloride

Controlled Product

CAS: 217313-79-6

Applications 4-Aminomethyl Benzamidine Dihydrochloride is a small molecule CXCR4 antagonist.
References Zhan, Weiqiang, et al.: J. of Med. Chem., 50(23), 5655-5664 (2007)

Formula: C₈H₁₁N₃·2(HCl)

Color and Shape: Neat

Molecular weight: 222.11

Ref: TR-A577045

4-Aminomethyl benzamidine dihydrochloride

CAS: 217313-79-6

Formula: C₈H₁₃Cl₂N₃

Purity: 96%

Color and Shape: Solid, White powder

Molecular weight: 222.11

Ref: 10-F011383