CAS 21739-93-5: 2-Bromo-5-chlorobenzoic acid
Description:2-Bromo-5-chlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and chlorine substituents on the benzene ring. Specifically, the bromine atom is located at the second position and the chlorine atom at the fifth position relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring. It exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of halogens can influence its reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 2-Bromo-5-chlorobenzoic acid can serve as an intermediate in the synthesis of more complex molecules, highlighting its significance in chemical research and industrial applications. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H4BrClO2
InChI:InChI=1S/C7H4BrClO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11)
InChI key:InChIKey=RBCPJQQJBAQSOU-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(Cl)=CC=C1Br
- Synonyms:
- 2-Bromo-5-Chloro-Benzoic Acid
- 2-Bromo-5-Chlorobenzoate
- 5-Chloro-2-bromobenzoic acid
- 6-Bromo-3-chlorobenzoic acid
- Benzoic acid, 2-bromo-5-chloro-
- NSC 128879
- 2-Bromo-5-chlorobenzoic acid

2-Bromo-5-chlorobenzoic acid, 98+%
Ref: 02-A10103
1g | To inquire | ||
5g | To inquire | ||
25g | To inquire |

2-Bromo-5-chlorobenzoic acid
Ref: IN-DA003GPD
1g | 22.00 € | ||
5g | 21.00 € | ||
10g | 26.00 € | ||
25g | 32.00 € | ||
100g | 68.00 € |

2-Bromo-5-chlorobenzoic acid
Ref: 10-F018255
1g | 29.00 € | ||
10g | 33.00 € | ||
25g | 36.00 € | ||
100g | 114.00 € | ||
500g | 267.00 € |

2-Bromo-5-chlorobenzoic acid
Ref: 54-OR1478
5g | 32.00 € | ||
25g | 50.00 € |

2-Bromo-5-chlorobenzoic Acid
Ref: 3B-B3112
5g | 66.00 € |

2-Bromo-5-chlorobenzoic acid
Ref: 3D-FB37744
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information | |
250g | Discontinued | Request information |