CymitQuimica logo

CAS 2173991-59-6

:

1-Azaspiro[3.3]heptane, 6,6-difluoro-, ethanedioate (2:1)

Description:
1-Azaspiro[3.3]heptane, 6,6-difluoro-, ethanedioate (2:1) is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom incorporated into a bicyclic framework. The presence of two fluorine atoms at the 6-position enhances its reactivity and may influence its physical properties, such as boiling and melting points. The ethanedioate component indicates that the compound forms a salt or ester with oxalic acid, which can affect its solubility and stability in various solvents. This compound is likely to exhibit interesting biological activity due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions may be influenced by the spiro configuration and the electronegative fluorine atoms, which can alter electron density and steric hindrance. Overall, 1-Azaspiro[3.3]heptane, 6,6-difluoro-, ethanedioate (2:1) represents a complex and potentially useful compound in the field of organic synthesis and pharmaceutical development.
Formula:C6H9F2NC2H2O4
InChI:InChI=1S/C6H9F2N.C2H2O4/c7-6(8)3-5(4-6)1-2-9-5;3-1(4)2(5)6/h9H,1-4H2;(H,3,4)(H,5,6)
InChI key:InChIKey=OLXQWYBWQLIOCQ-UHFFFAOYSA-N
SMILES:FC1(F)CC2(C1)CCN2.C(C(O)=O)(O)=O
Synonyms:
  • 1-Azaspiro[3.3]heptane, 6,6-difluoro-, ethanedioate (2:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.