CymitQuimica logo

CAS 2173991-63-2

:

1H-Pyrazole, 5-bromo-1,3-dimethyl-, hydrochloride (1:1)

Description:
1H-Pyrazole, 5-bromo-1,3-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 5-position and two methyl groups at the 1 and 3 positions contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or antitumor activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 1H-Pyrazole, 5-bromo-1,3-dimethyl-, hydrochloride is a significant compound in medicinal chemistry and research.
Formula:C5H7BrN2·ClH
InChI:InChI=1S/C5H7BrN2.ClH/c1-4-3-5(6)8(2)7-4;/h3H,1-2H3;1H
InChI key:InChIKey=DLKKVCTUQPMXOD-UHFFFAOYSA-N
SMILES:BrC=1N(C)N=C(C)C1.Cl
Synonyms:
  • 1H-Pyrazole, 5-bromo-1,3-dimethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.