CymitQuimica logo

CAS 2173991-78-9

:

Bicyclo[1.1.1]pentane-1-carboxylic acid, 3-(aminomethyl)-, hydrochloride (1:1)

Description:
Bicyclo[1.1.1]pentane-1-carboxylic acid, 3-(aminomethyl)-, hydrochloride (1:1) is a bicyclic organic compound characterized by its unique bicyclo[1.1.1]pentane structure, which consists of a fused ring system that contributes to its rigidity and distinctive chemical properties. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions, while the aminomethyl group suggests potential for hydrogen bonding and reactivity with electrophiles. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. The compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 2173991-78-9, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in research and industry. Overall, this compound's unique structure and functional groups position it as a valuable entity in chemical research.
Formula:C7H11NO2·ClH
InChI:InChI=1S/C7H11NO2.ClH/c8-4-6-1-7(2-6,3-6)5(9)10;/h1-4,8H2,(H,9,10);1H
InChI key:InChIKey=QUFHHGJRYWRADR-UHFFFAOYSA-N
SMILES:C(O)(=O)C12CC(CN)(C1)C2.Cl
Synonyms:
  • 3-(Aminomethyl)bicyclo[1.1.1]pentane-1-carboxylic acid hydrochloride
  • Bicyclo[1.1.1]pentane-1-carboxylic acid, 3-(aminomethyl)-, hydrochloride (1:1)
Found 5 products.