CAS 2174-59-6: 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-4-one
Description:2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-4-one, commonly referred to by its CAS number 2174-59-6, is a flavonoid compound characterized by its complex structure that includes multiple methoxy groups and a chromenone backbone. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The presence of hydroxyl and methoxy substituents enhances its solubility and reactivity, contributing to its biological efficacy. Its structural features allow for interactions with various biological targets, which may lead to diverse therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-4-one represents a significant area of study within natural product chemistry and medicinal chemistry due to its potential health benefits and applications in drug development.
Formula:C20H20O8
InChI:InChI=1S/C20H20O8/c1-23-12-7-6-10(8-14(12)24-2)13-9-11(21)15-16(22)18(25-3)20(27-5)19(26-4)17(15)28-13/h6-9,22H,1-5H3
InChI key:InChIKey=DOFJNFPSMUCECH-UHFFFAOYSA-N
SMILES:O=C1C=C(OC2=C(OC)C(OC)=C(OC)C(O)=C12)C=3C=CC(OC)=C(OC)C3
- Synonyms:
- 2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one
- 2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxychromen-4-one
- 4H-1-benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-
- 5-Demethylnobiletin
- 5-Desmethylnobiletin
- 5-Hydroxy-3′,4′,6,7,8-pentamethoxyflavone
- 5-Hydroxy-6,7,8,3′,4′-pentamethoxyflavone
- 5-O-Demethylnobiletin
- 5-O-Desmethylnobiletin
- Flavone, 5-hydroxy-3′,4′,6,7,8-pentamethoxy-
- See more synonyms
- NSC 618927
