CAS 21740-00-1
:5-Bromo-2-iodobenzoic acid
Description:
5-Bromo-2-iodobenzoic acid is an organic compound characterized by the presence of both bromine and iodine substituents on a benzoic acid framework. It features a carboxylic acid functional group (-COOH) attached to a benzene ring, which is further substituted at the 5 and 2 positions with bromine and iodine atoms, respectively. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure contributes to its reactivity, making it useful in various chemical reactions, including coupling reactions and as a building block for more complex molecules. The presence of halogens can influence the compound's solubility, stability, and reactivity, often enhancing its biological activity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-2-iodobenzoic acid is a valuable compound in research and industrial applications due to its unique chemical properties.
Formula:C7H3BrIO2
InChI:InChI=1/C7H4BrIO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)/p-1
SMILES:c1cc(c(cc1Br)C(=O)[O-])I
Synonyms:- 2-Iodo-5-Bromobenzoic Acid
- Rarechem Al Bo 0892
- 5-Bromo-2-Iodobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-iodobenzoic Acid
CAS:Formula:C7H4BrIO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:326.925-Bromo-2-iodobenzoic acid, 97%
CAS:It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand.
Formula:C7H3BrIO2Purity:97%Molecular weight:325.915-Bromo-2-iodobenzoic acid
CAS:Formula:C7H4BrIO2Purity:98%Color and Shape:SolidMolecular weight:326.91395-Bromo-2-iodobenzoic acid
CAS:5-Bromo-2-iodobenzoic acidFormula:C7H4BrIO2Purity:97%Color and Shape: pale yellow solidMolecular weight:326.91g/mol5-Bromo-2-iodobenzoic acid
CAS:Formula:C7H4BrIO2Purity:98%Color and Shape:SolidMolecular weight:326.915




