CAS 21742-00-7: 2-Trifluoromethylbenzyl chloride
Description:2-Trifluoromethylbenzyl chloride, with the CAS number 21742-00-7, is an organic compound characterized by the presence of a benzyl group substituted with a trifluoromethyl group and a chlorine atom. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive aromatic properties due to the benzyl moiety. The trifluoromethyl group contributes to its unique reactivity and stability, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of chlorine enhances its electrophilic character, facilitating various substitution reactions. Additionally, 2-Trifluoromethylbenzyl chloride is relatively insoluble in water but soluble in organic solvents, which is common for many halogenated organic compounds. Safety precautions are essential when handling this substance, as it may pose health risks through inhalation or skin contact, and it is advisable to use appropriate personal protective equipment. Overall, its chemical properties make it a significant compound in synthetic organic chemistry.
Formula:C8H6ClF3
InChI:InChI=1S/C8H6ClF3/c9-5-6-3-1-2-4-7(6)8(10,11)12/h1-4H,5H2
InChI key:InChIKey=BBXDMCQDLOCXRA-UHFFFAOYSA-N
SMILES:FC(F)(F)C=1C=CC=CC1CCl
- Synonyms:
- 2-Trifluoromethylbenzyl chloride
- Benzene, 1-(chloromethyl)-2-(trifluoromethyl)-
- 1-(Chloromethyl)-2-(trifluoromethyl)benzene
- o-Xylene, α′-chloro-α,α,α-trifluoro-

2-(Trifluoromethyl)benzyl Chloride
Ref: 3B-T2731
5g | 65.00 € | ||
25g | 191.00 € |

Benzene, 1-(chloromethyl)-2-(trifluoromethyl)-
Ref: IN-DA003F5P
1g | 24.00 € | ||
5g | 45.00 € | ||
10g | 63.00 € | ||
25g | 82.00 € | ||
100g | 186.00 € | ||
500g | To inquire |

2-(Trifluoromethyl)benzyl chloride
Ref: 54-PC7633E
5g | 32.00 € | ||
25g | 52.00 € | ||
100g | 143.00 € |

2-(Trifluoromethyl)benzyl chloride
Ref: 10-F007608
1g | 29.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
25g | To inquire |

2-(Trifluoromethyl)benzyl chloride
Ref: 3D-FT63926
250g | 725.00 € |