CAS 21743-64-6
:2H-Tetrazole-2-acetic acid
Description:
2H-Tetrazole-2-acetic acid, with the CAS number 21743-64-6, is a heterocyclic organic compound characterized by the presence of a tetrazole ring and an acetic acid functional group. This compound features a five-membered ring containing four nitrogen atoms and one carbon atom, which contributes to its unique chemical properties. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, making it versatile for various applications. The presence of both acidic (carboxylic acid) and basic (tetrazole) functional groups allows for interesting reactivity, including potential coordination with metal ions and participation in various chemical reactions. 2H-Tetrazole-2-acetic acid is often studied for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis due to its ability to form stable complexes and its bioactivity. Its stability and reactivity can be influenced by pH and the presence of other functional groups in a reaction mixture.
Formula:C3H4N4O2
InChI:InChI=1S/C3H4N4O2/c8-3(9)1-7-5-2-4-6-7/h2H,1H2,(H,8,9)
InChI key:InChIKey=ZYHXBGMQUWRUBE-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1N=CN=N1
Synonyms:- 2-(2H-1,2,3,4-Tetrazol-2-yl)acetic acid
- 2-Tetrazolylacetic acid
- 2H-Tetrazole-2-acetic acid
- 2H-tetrazol-2-ylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2H-tetrazol-2-ylacetic acid
CAS:2-Hydrazinotetrazole is an organic compound that can be synthesized from 2-amino-5-nitrotetrazole and hydrazine. The 2H-tetrazol-2-ylacetic acid (TZ) isomer has been shown to have resonance at 3.9 ppm. It also has a chemical shift of 3.3 ppm, which corresponds to the methylene groups in the molecule. When observed by magnetic resonance spectroscopy, it displays a doublet of triplets with an intensity ratio of 1:1:1. This indicates that there are three distinct isomers with different orientations in space, which correspond to the E, Z, and EZ isomers.Formula:C3H4N4O2Purity:Min. 95%Molecular weight:128.89 g/mol
