CAS 217448-86-7
:Methyl 1-[(2,6-difluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylate
Description:
Methyl 1-[(2,6-difluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylate is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of the 2,6-difluorophenyl group enhances its biological activity and lipophilicity, making it of interest in pharmaceutical applications. The triazole moiety is known for its role in various biological activities, including antifungal and antimicrobial properties. Additionally, the compound's structure suggests potential interactions with biological targets, which may be explored in drug development. Its CAS number, 217448-86-7, allows for easy identification in chemical databases. Overall, this compound exemplifies the diverse functionalities that can be achieved through the incorporation of specific substituents on a triazole scaffold, making it a subject of interest in medicinal chemistry and related fields.
Formula:C11H9F2N3O2
InChI:InChI=1S/C11H9F2N3O2/c1-18-11(17)10-6-16(15-14-10)5-7-8(12)3-2-4-9(7)13/h2-4,6H,5H2,1H3
InChI key:InChIKey=XVEURJOWGBWEPY-UHFFFAOYSA-N
SMILES:C(C1=C(F)C=CC=C1F)N2C=C(C(OC)=O)N=N2
Synonyms:- Methyl 1-[(2,6-difluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylate
- 1H-1,2,3-Triazole-4-carboxylic acid, 1-[(2,6-difluorophenyl)methyl]-, methyl ester
- 1-(2,6-Difluorobenzyl)-1,2,3-triazole-4-carboxylic acid methyl ester
- 1-(2,6-Difluorobenzyl)-1H-1,2,3-triazole-4-carboxylic acid methyl ester
- Methyl 1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Rufinamide Related Compound B (Methyl 1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylate)
CAS:Aromatic or modified aromatic heterocyclic compounds wiFormula:C11H9F2N3O2Color and Shape:White PowderMolecular weight:253.06628METHYL 1-(2,6-DIFLUOROBENZYL)-1H-1,2,3-TRIAZOLE-4-CARBOXYLATE
CAS:Formula:C11H9F2N3O2Purity:98%Color and Shape:SolidMolecular weight:253.2049Methyl 1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylate
CAS:Methyl 1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylate
Purity:98%Molecular weight:253.21g/molRufinamide USP Related Compound B
CAS:Formula:C11H9F2N3O2Color and Shape:White To Off-White SolidMolecular weight:253.21Rufinamide USP Related Compound B
CAS:Controlled ProductFormula:C11H9F2N3O2Color and Shape:NeatMolecular weight:253.204-Descarboxamido Rufinamide 4-Methyl Ester
CAS:Controlled ProductApplications 4-Descarboxamido Rufinamide 4-Methyl Ester is an impurity in the synthesis of Rufinamide (R701550), an antiepileptic triazole derivative which decreases firing by neurons at sodium channels. Anticonvulsant.
References Cheung, W.K., et al.: Pharm. Res., 12, 1878 (1995), Cardot, J.-M., et al.: Biopharm. Drug Dispos., 19, 259 (1998), Palhagen, S., et al.: Epilepsy Res., 43, 115 (2001),Formula:C11H9F2N3O2Color and Shape:NeatMolecular weight:253.2Methyl 1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylate
CAS:Formula:C11H9F2N3O2Purity:≥98%Molecular weight:253.209








