CAS 217448-86-7: Methyl 1-[(2,6-difluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylate
Description:Methyl 1-[(2,6-difluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylate is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of the 2,6-difluorophenyl group enhances its biological activity and lipophilicity, making it of interest in pharmaceutical applications. The triazole moiety is known for its role in various biological activities, including antifungal and antimicrobial properties. Additionally, the compound's structure suggests potential interactions with biological targets, which may be explored in drug development. Its CAS number, 217448-86-7, allows for easy identification in chemical databases. Overall, this compound exemplifies the diverse functionalities that can be achieved through the incorporation of specific substituents on a triazole scaffold, making it a subject of interest in medicinal chemistry and related fields.
Formula:C11H9F2N3O2
InChI:InChI=1S/C11H9F2N3O2/c1-18-11(17)10-6-16(15-14-10)5-7-8(12)3-2-4-9(7)13/h2-4,6H,5H2,1H3
InChI key:InChIKey=XVEURJOWGBWEPY-UHFFFAOYSA-N
SMILES:O=C(OC)C=1N=NN(C1)CC=2C(F)=CC=CC2F
- Synonyms:
- Methyl 1-[(2,6-difluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylate
- 1H-1,2,3-Triazole-4-carboxylic acid, 1-[(2,6-difluorophenyl)methyl]-, methyl ester
- 1-(2,6-Difluorobenzyl)-1,2,3-triazole-4-carboxylic acid methyl ester
- 1-(2,6-Difluorobenzyl)-1H-1,2,3-triazole-4-carboxylic acid methyl ester
- Methyl 1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylate
![Methyl 1-[(2,6-difluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylate](https://static.cymitquimica.com/cas-image/56021-methyl-1-26-difluorophenyl-methyl-1h-123-triazole-4-carboxylate.png)
