CAS 217476-73-8

Lucidumol A

Description:

Lucidumol A, with the CAS number 217476-73-8, is a chemical compound that belongs to the class of triterpenoids, specifically derived from the Ganoderma lucidum fungus, commonly known as reishi mushroom. This compound is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Lucidumol A has garnered interest in pharmacological research due to its potential health benefits, including anti-inflammatory, antioxidant, and anticancer properties. Its mechanism of action may involve modulation of various signaling pathways and inhibition of specific enzymes. Additionally, Lucidumol A is often studied for its role in traditional medicine, particularly in Asian cultures, where Ganoderma lucidum has been used for centuries to promote health and longevity. As with many natural products, the extraction and purification of Lucidumol A can be challenging, and ongoing research aims to elucidate its full therapeutic potential and safety profile.

Formula: C₃₀H₄₈O₄

InChI: InChI=1S/C30H48O4/c1-18(9-10-24(33)27(4,5)34)19-11-16-30(8)25-20(12-15-29(19,30)7)28(6)14-13-23(32)26(2,3)22(28)17-21(25)31/h18-19,22,24,33-34H,9-17H2,1-8H3/t18-,19-,22+,24+,28-,29-,30+/m1/s1

InChI key: InChIKey=LVGCWXNRZNCAJG-AMKDLFIQSA-N

SMILES: C[C@]12C3=C([C@]4(C)[C@@](CC3=O)(C(C)(C)C(=O)CC4)[H])CC[C@]1(C)[C@@]([C@@H](CC[C@@H](C(C)(C)O)O)C)(CC2)[H]

Synonyms:

• Lucidumol A
• (24S)-24,25-Dihydroxylanost-8-ene-3,7-dione
• Lanost-8-ene-3,7-dione, 24,25-dihydroxy-, (24S)-

Lucidumol A

CAS: 217476-73-8

Lucidumol A is a triterpenoid compound, which is isolated from the medicinal mushroom *Ganoderma lucidum*. This compound is notable for its ability to modulate multiple biological pathways, primarily through its anti-inflammatory and antioxidant properties. By inhibiting pro-inflammatory cytokines and reactive oxygen species, Lucidumol A exerts protective effects at the cellular level, reducing oxidative stress and modulating immune responses.Lucidumol A has piqued the interest of researchers due to its potential therapeutic applications. It is studied for its role in alleviating conditions associated with chronic inflammation and oxidative stress, which are common in various degenerative diseases. The compound’s ability to modulate immune function and prevent cellular damage positions it as a candidate for further investigation in both clinical and preclinical settings. Its natural origin and bioactivity provide a promising avenue for developing novel therapeutic agents derived from traditional medicine sources, emphasizing the intersection of natural products and modern pharmacology.

Formula: C₃₀H₄₈O₄

Purity: Min. 95%

Molecular weight: 472.70 g/mol

Ref: 3D-SIA47673