CAS 217480-26-7: methyl (2S)-2-[4-(5,7-difluoro-2-phenyl-1H-indol-3-yl)butanoylamino]-5-guanidino-pentanoate; 2,2,2-trifluoroacetic acid
Description:Methyl (2S)-2-[4-(5,7-difluoro-2-phenyl-1H-indol-3-yl)butanoylamino]-5-guanidino-pentanoate; 2,2,2-trifluoroacetic acid is a complex organic compound characterized by its unique structural features, including a guanidine group and an indole moiety, which contribute to its potential biological activity. The presence of fluorine atoms in the structure enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. The trifluoroacetic acid component suggests that it may be used in various chemical reactions or as a solvent in organic synthesis. Additionally, the stereochemistry indicated by the (2S) configuration implies that the compound may exhibit chirality, which can affect its biological activity and interactions. Overall, this compound's intricate structure and functional groups position it as a candidate for further investigation in pharmaceutical applications, particularly in the development of therapeutics targeting specific biological pathways.
Formula:C27H30F5N5O5
InChI:InChI=1/C25H29F2N5O3.C2HF3O2/c1-35-24(34)20(10-6-12-30-25(28)29)31-21(33)11-5-9-17-18-13-16(26)14-19(27)23(18)32-22(17)15-7-3-2-4-8-15;3-2(4,5)1(6)7/h2-4,7-8,13-14,20,32H,5-6,9-12H2,1H3,(H,31,33)(H4,28,29,30);(H,6,7)/t20-;/m0./s1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | L-803087 REF: 54-BUP09477CAS: 217480-26-7 | ≥95% | 1,246.00 €~3,926.00 € | Mon 05 May 25 |
![]() | L-803087 REF: TM-T11800CAS: 217480-26-7 | 97.58% | 47.00 €~2,357.00 € | Wed 25 Jun 25 |
![]() | Methyl N2-[4-(5,7-Difluoro-2-Phenyl-1 REF: 3D-FM102822CAS: 217480-26-7 | Min. 95% | - - - | Discontinued product |

Ref: 54-BUP09477
25mg | 1,246.00 € | ||
50mg | 1,993.00 € | ||
100mg | 3,189.00 € | ||
200mg | 3,926.00 € |

L-803087
Ref: TM-T11800
1mg | 115.00 € | ||
5mg | 274.00 € | ||
10mg | 439.00 € | ||
25mg | 920.00 € | ||
50mg | 1,473.00 € | ||
100mg | 2,357.00 € | ||
1mL*10mM (DMSO) | 47.00 € |

Methyl N2-[4-(5,7-Difluoro-2-Phenyl-1
Ref: 3D-FM102822
1mg | Discontinued | Request information | |
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information |