CAS 217480-26-7

methyl (2S)-2-[4-(5,7-difluoro-2-phenyl-1H-indol-3-yl)butanoylamino]-5-guanidino-pentanoate; 2,2,2-trifluoroacetic acid

Description:

Methyl (2S)-2-[4-(5,7-difluoro-2-phenyl-1H-indol-3-yl)butanoylamino]-5-guanidino-pentanoate; 2,2,2-trifluoroacetic acid is a complex organic compound characterized by its unique structural features, including a guanidine group and an indole moiety, which contribute to its potential biological activity. The presence of fluorine atoms in the structure enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. The trifluoroacetic acid component suggests that it may be used in various chemical reactions or as a solvent in organic synthesis. Additionally, the stereochemistry indicated by the (2S) configuration implies that the compound may exhibit chirality, which can affect its biological activity and interactions. Overall, this compound's intricate structure and functional groups position it as a candidate for further investigation in pharmaceutical applications, particularly in the development of therapeutics targeting specific biological pathways.

Formula: C₂₇H₃₀F₅N₅O₅

InChI: InChI=1/C25H29F2N5O3.C2HF3O2/c1-35-24(34)20(10-6-12-30-25(28)29)31-21(33)11-5-9-17-18-13-16(26)14-19(27)23(18)32-22(17)15-7-3-2-4-8-15;3-2(4,5)1(6)7/h2-4,7-8,13-14,20,32H,5-6,9-12H2,1H3,(H,31,33)(H4,28,29,30);(H,6,7)/t20-;/m0./s1

SMILES: COC(=O)[C@H](CCCNC(=N)N)N=C(CCCc1c2cc(cc(c2[nH]c1c1ccccc1)F)F)O.C(=O)(C(F)(F)F)O

L-803087

CAS: 217480-26-7

L-803087

Purity: ≥95%

Molecular weight: 485.53g/mol

Ref: 54-BUP09477

L-803087

CAS: 217480-26-7

L-803087: potent sst4 receptor agonist, 0.7 nM Ki, 280x selectivity, boosts AMPA responses & seizures in mice.

Formula: C₂₅H₂₉F₂N₅O₃

Purity: 99.37%

Color and Shape: Solid

Molecular weight: 485.53

Ref: TM-T11800