CAS 217491-04-8

[1,2,5]oxadiazolo[3,4-f]cinnoline

Description:

[1,2,5]Oxadiazolo[3,4-f]cinnoline is a heterocyclic compound characterized by its unique fused ring structure, which incorporates both oxadiazole and cinnoline moieties. This compound typically exhibits a range of interesting chemical properties due to the presence of nitrogen atoms in its rings, which can influence its reactivity and stability. It is often studied for its potential applications in pharmaceuticals, agrochemicals, and materials science due to its biological activity and electronic properties. The compound may display fluorescence, making it useful in various sensing applications. Additionally, its structural features can lead to diverse interactions with biological targets, which is of particular interest in medicinal chemistry. The synthesis of such compounds often involves multi-step organic reactions, and their characterization can be achieved through techniques like NMR, mass spectrometry, and X-ray crystallography. Overall, [1,2,5]oxadiazolo[3,4-f]cinnoline represents a fascinating area of study within the field of organic and medicinal chemistry.

Formula: C₈H₄N₄O

InChI: InChI=1/C8H4N4O/c1-2-7-8(12-13-11-7)5-3-4-9-10-6(1)5/h1-4H

SMILES: c1cc2c(c3ccnnc13)non2

1,2,5-Oxadiazolo[3,4-f]cinnoline

CAS: 217491-04-8

1,2,5-Oxadiazolo[3,4-f]cinnoline

Purity: ≥95%

Molecular weight: 172.14g/mol

Ref: 54-OR0692