CAS 2175-91-9

6,6-Dimethylfulvene

Description:

6,6-Dimethylfulvene is an organic compound characterized by its unique structure, which features a fulvene framework with two methyl groups attached to the sixth carbon atom. This compound is a derivative of fulvene, a five-membered cyclic compound containing a conjugated system of double bonds. 6,6-Dimethylfulvene is known for its reactivity, particularly in Diels-Alder reactions, due to the presence of the highly reactive double bonds. It typically appears as a colorless to pale yellow liquid and has a distinctive aromatic odor. The compound is relatively stable under standard conditions but can undergo polymerization or other reactions when exposed to heat or light. Its applications are primarily found in organic synthesis and materials science, where it can serve as a building block for more complex molecules. Additionally, due to its unique electronic properties, it has potential uses in the development of organic electronic materials. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₈H₁₀

InChI: InChI=1/C8H10/c1-7(2)8-5-3-4-6-8/h3-6H,1-2H3

SMILES: CC(=C1C=CC=C1)C

Synonyms:

• 1,3-Cyclopentadiene, 5-(1-methylethylidene)-
• 5-(Propan-2-Ylidene)Cyclopenta-1,3-Diene

6,6-Dimethylfulvene

CAS: 2175-91-9

Formula: C₈H₁₀

Purity: >95.0%(GC)

Color and Shape: Light yellow to Brown clear liquid

Molecular weight: 106.17

Ref: 3B-D2786

5-PROPAN-2-YLIDENECYCLOPENTA-1,3-DIENE

CAS: 2175-91-9

Formula: C₈H₁₀

Purity: %

Color and Shape: Liquid

Molecular weight: 106.1650

Ref: IN-DA0037TT

6,6-Dimethylfulvene

CAS: 2175-91-9

6,6-Dimethylfulvene

Formula: C₈H₁₀

Purity: 97%

Color and Shape: clear. yellow liquid

Molecular weight: 106.17g/mol

Ref: 54-OR52345

5-(Propan-2-ylidene)cyclopenta-1,3-diene

CAS: 2175-91-9

Purity: 95.0%

Color and Shape: Liquid, Clear pale yellow to yellow red liquid

Molecular weight: 106.16799926757812

Ref: 10-F227440