CAS 21752-32-9
:L-Methionine-(S)-sulfoximine
Description:
L-Methionine-(S)-sulfoximine, with the CAS number 21752-32-9, is a sulfoximine derivative of the amino acid methionine. This compound features a sulfoximine functional group, which is characterized by the presence of a sulfur atom bonded to both an oxygen atom and a nitrogen atom. L-Methionine itself is an essential amino acid, playing a crucial role in protein synthesis and serving as a precursor for various biomolecules. The sulfoximine modification can impart unique properties, such as enhanced solubility and potential biological activity. This compound is of interest in biochemical research and may have applications in agriculture, particularly as a herbicide or plant growth regulator, due to its ability to influence metabolic pathways. Additionally, the presence of the sulfoximine group may enhance its interaction with biological systems, making it a subject of study for its potential therapeutic effects. Overall, L-Methionine-(S)-sulfoximine represents a fascinating intersection of amino acid chemistry and functional group modification.
Formula:C5H12N2O3S
InChI:InChI=1S/C5H12N2O3S/c1-11(7,10)3-2-4(6)5(8)9/h4,7H,2-3,6H2,1H3,(H,8,9)/t4-,11-/m0/s1
InChI key:InChIKey=SXTAYKAGBXMACB-AUIPBDMJSA-N
SMILES:C([C@@H](C(O)=O)N)CS(C)(=N)=O
Synonyms:- L-Methionine-(S)-sulfoximine
- Butanoic acid, 2-amino-4-[[S(S)]-S-methylsulfonimidoyl]-, (2S)-
- (2S)-2-Amino-4-[[S(S)]-S-methylsulfonimidoyl]butanoic acid
- Butanoic acid, 2-amino-4-(S-methylsulfonimidoyl)-, [S-(R*,R*)]-
- Sulfoximine, S-(3-amino-3-carboxypropyl)-S-methyl-, (S)-L-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-Methionine [S]-Sulfoximine
CAS:Controlled ProductFormula:C5H12N2O3SColor and Shape:NeatMolecular weight:180.23
