CAS 21753-16-2
:5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione
Description:
5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione, also known by its CAS number 21753-16-2, is a chemical compound characterized by its unique structure that combines an indole moiety with an imidazolidine-2,4-dione framework. This compound typically exhibits properties associated with both heterocyclic compounds and those containing nitrogen functionalities. The presence of the indole ring suggests potential biological activity, as indoles are known for their roles in various pharmacological applications. The imidazolidine-2,4-dione portion contributes to its reactivity and stability, making it a candidate for further chemical modifications. In terms of solubility, it may exhibit moderate solubility in polar solvents, which is common for compounds with such functional groups. The compound's potential applications could span medicinal chemistry, particularly in the development of new therapeutic agents, due to the biological significance of both indole and imidazolidine derivatives. Overall, 5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione represents an interesting target for research in organic and medicinal chemistry.
Formula:C12H11N3O2
InChI:InChI=1/C12H11N3O2/c16-11-10(14-12(17)15-11)5-7-6-13-9-4-2-1-3-8(7)9/h1-4,6,10,13H,5H2,(H2,14,15,16,17)
SMILES:c1ccc2c(c1)c(CC1C(=NC(=N1)O)O)c[nH]2
Synonyms:- 2,4-imidazolidinedione, 5-(1H-indol-3-ylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5-(1H-Indol-3-ylmethyl)imidazolidine-2,4-dione
CAS:Controlled ProductFormula:C12H11N3O2Color and Shape:NeatMolecular weight:229.23


