
CAS 21755-66-8
:Picoperine
Description:
Picoperine, with the CAS number 21755-66-8, is a chemical compound that belongs to the class of piperidine derivatives. It is characterized by its unique molecular structure, which includes a piperidine ring, contributing to its biological activity. Picoperine is known for its potential pharmacological properties, including anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry. The compound is typically studied for its interactions with various biological targets, which may lead to therapeutic applications. Its solubility, stability, and reactivity can vary depending on the specific conditions and solvents used. As with many chemical substances, safety and handling precautions are essential, as it may exhibit toxicity or other hazardous properties. Research into Picoperine continues to explore its full range of biological activities and potential uses in drug development.
Formula:C19H25N3
InChI:InChI=1S/C19H25N3/c1-3-10-19(11-4-1)22(17-18-9-5-6-12-20-18)16-15-21-13-7-2-8-14-21/h1,3-6,9-12H,2,7-8,13-17H2
InChI key:InChIKey=MVMXJBMAGBRAHD-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=N1)(CCN2CCCCC2)C3=CC=CC=C3
Synonyms:- Piperidine, 1-[2-[N-(2-pyridylmethyl)anilino]ethyl]-
- N-(2-Picolyl)-N-phenyl-N-(2-piperidinoethyl)amine
- Picoperine
- 2-Pyridinemethanamine, N-phenyl-N-[2-(1-piperidinyl)ethyl]-
- N-Phenyl-N-[2-(1-piperidinyl)ethyl]-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Picoperine
CAS:Picoperine is a biochemical.Formula:C19H25N3Color and Shape:SolidMolecular weight:295.42
