CAS 2176-14-9
:3,5-Dimethoxy-4-hydroxyphenethylamine hydrochloride
Description:
3,5-Dimethoxy-4-hydroxyphenethylamine hydrochloride, also known as 2-(3,5-dimethoxy-4-hydroxyphenyl)ethanamine hydrochloride, is a chemical compound that belongs to the class of phenethylamines. It features a phenolic hydroxyl group and two methoxy groups on the aromatic ring, contributing to its unique properties. This compound is often studied for its potential psychoactive effects and has been of interest in the field of medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water, which facilitates its use in various biological and chemical applications. The presence of the hydroxyl and methoxy groups can influence its interaction with biological receptors, potentially affecting its pharmacological profile. While specific applications may vary, compounds of this nature are often explored for their roles in neurotransmitter modulation and their potential therapeutic effects. Safety and handling precautions are essential when working with this substance, as with any chemical compound, due to its biological activity and potential effects on human health.
Formula:C10H16ClNO3
InChI:InChI=1/C10H15NO3.ClH/c1-13-8-5-7(3-4-11)6-9(14-2)10(8)12;/h5-6,12H,3-4,11H2,1-2H3;1H
SMILES:COc1cc(CCN)cc(c1O)OC.Cl
Synonyms:- 4-(2-Aminoethyl)-2,6-Dimethoxyphenol Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3,5-Dimethoxy-4-hydroxyphenethylamine hydrochloride
CAS:Controlled Product<p>3,5-Dimethoxy-4-hydroxyphenethylamine hydrochloride is a fine chemical that is used as a building block for other compounds and as a reagent in research. It has been shown to be an effective intermediate in the synthesis of many complex compounds, such as 3,4-methylenedioxyamphetamine (MDA) and 3,4-methylenedioxymethamphetamine (MDMA), which are both psychoactive drugs. This building block can also be used to synthesize speciality chemicals such as psychotropic drugs or pharmaceuticals.</p>Formula:C10H16ClNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:233.69 g/mol
