CymitQuimica logo

CAS 21761-08-0

:

N2-(2,2,2-Trifluoroacetyl)-L-lysine

Description:
N2-(2,2,2-Trifluoroacetyl)-L-lysine, with the CAS number 21761-08-0, is a derivative of the amino acid lysine, modified by the addition of a trifluoroacetyl group at the nitrogen atom of the amino group. This compound is characterized by its unique trifluoromethyl group, which imparts distinct electronic and steric properties, enhancing its reactivity and potential applications in various chemical reactions. It is typically a white to off-white solid, soluble in polar solvents, and may exhibit specific biological activities due to its structural modifications. The trifluoroacetyl group can influence the compound's stability, lipophilicity, and interaction with biological targets, making it of interest in medicinal chemistry and biochemistry. Additionally, the presence of the lysine backbone suggests potential for peptide synthesis and modification, contributing to its utility in research and pharmaceutical development. As with many fluorinated compounds, it may also exhibit unique properties such as increased metabolic stability and altered pharmacokinetics.
Formula:C8H13F3N2O3
InChI:InChI=1S/C8H13F3N2O3/c9-8(10,11)7(16)13-5(6(14)15)3-1-2-4-12/h5H,1-4,12H2,(H,13,16)(H,14,15)/t5-/m0/s1
InChI key:InChIKey=KNCHTBNNSQSLRV-YFKPBYRVSA-N
SMILES:[C@H](NC(C(F)(F)F)=O)(CCCCN)C(O)=O
Synonyms:
  • N2-(Trifluoroacetyl)-L-lysine
  • N2-(2,2,2-Trifluoroacetyl)-L-lysine
  • Lysine, N2-(trifluoroacetyl)-, L-
  • L-Lysine, N2-(trifluoroacetyl)-
  • L-Lysine, N2-(2,2,2-trifluoroacetyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.