CAS 21763-07-5

6,7-dimethoxy-1,4-dihydroisoquinolin-3(2H)-one

Description:

6,7-Dimethoxy-1,4-dihydroisoquinolin-3(2H)-one is a chemical compound characterized by its isoquinoline structure, which features a bicyclic system composed of a benzene ring fused to a pyridine ring. This compound contains two methoxy groups (-OCH3) at the 6 and 7 positions, contributing to its unique chemical properties and potential biological activity. The presence of the dihydro form indicates that it has a saturated bond in the isoquinoline framework, which can influence its reactivity and stability. The compound is often studied for its pharmacological properties, including potential neuroprotective and anti-inflammatory effects. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility, melting point, and reactivity can vary based on the presence of the methoxy groups and the overall molecular conformation. As with many organic compounds, proper handling and safety precautions are essential when working with this substance in a laboratory setting.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-14-9-3-7-5-11(13)12-6-8(7)4-10(9)15-2/h3-4H,5-6H2,1-2H3,(H,12,13)

SMILES: COc1cc2CC(=NCc2cc1OC)O

Synonyms:

• 3(2H)-isoquinolinone, 1,4-dihydro-6,7-dimethoxy-