CAS 21764-08-9

3'-Benzyloxy-4',5,6,7-tetramethoxyflavone

Description:

3'-Benzyloxy-4',5,6,7-tetramethoxyflavone, identified by its CAS number 21764-08-9, is a flavonoid compound characterized by its complex structure, which includes multiple methoxy groups and a benzyloxy substituent. This compound typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. The presence of methoxy groups enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological membranes. Additionally, the benzyloxy group may contribute to its stability and solubility in organic solvents. As with many flavonoids, it may also exhibit UV-Vis absorbance characteristics, which can be utilized in analytical chemistry for its detection and quantification. Overall, 3'-Benzyloxy-4',5,6,7-tetramethoxyflavone represents a significant compound within the flavonoid class, with implications for both natural product chemistry and medicinal applications.

Formula: C₂₆H₂₄O₇

InChI: InChI=1/C26H24O7/c1-28-19-11-10-17(12-21(19)32-15-16-8-6-5-7-9-16)20-13-18(27)24-22(33-20)14-23(29-2)25(30-3)26(24)31-4/h5-14H,15H2,1-4H3

SMILES: COc1ccc(cc1OCc1ccccc1)c1cc(=O)c2c(cc(c(c2OC)OC)OC)o1

Synonyms:

• 2-[3-(benzyloxy)-4-methoxyphenyl]-5,6,7-trimethoxy-4H-chromen-4-one

3'-Benzyloxy-4',5,6,7-tetramethoxyflavone

CAS: 21764-08-9

3'-Benzyloxy-4',5,6,7-tetramethoxyflavone is a synthetic flavone derivative, which is structurally modified from naturally occurring flavonoids. These compounds are often sourced from various plant species or created synthetically to mimic the beneficial components found in plant matter. The mode of action of this compound primarily hinges on its ability to interact with cellular pathways due to its polyphenolic structure. Such interactions may include the inhibition of certain enzymes, modulation of receptor activities, or altering oxidative states within cells.

Formula: C₂₆H₂₄O₇

Purity: Min. 95%

Molecular weight: 448.46 g/mol

Ref: 3D-FB66452