CAS 217661-27-3: 2-(Bromomethyl)-5-fluorobenzonitrile

Description:2-(Bromomethyl)-5-fluorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromomethyl group and a fluorine atom, as well as a nitrile functional group. The presence of the bromomethyl group introduces a reactive site that can participate in various chemical reactions, such as nucleophilic substitution. The fluorine atom enhances the compound's lipophilicity and can influence its reactivity and biological activity. The nitrile group contributes to the compound's polarity and can participate in hydrogen bonding interactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Its physical properties, such as melting point and solubility, would depend on the specific conditions and the presence of other substituents. Safety precautions should be observed when handling this compound, as it may pose health risks due to the presence of halogenated groups.

Formula:C₈H₅BrFN

InChI:InChI=1/C8H5BrFN/c9-4-6-1-2-8(10)3-7(6)5-11/h1-3H,4H2

Synonyms:
Benzonitrile, 2-(Bromomethyl)-5-Fluoro-
2-Cyano-4-Fluorobenzylbromide

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-(Bromomethyl)-5-fluorobenzonitrile REF: IN-DA007P6TCAS: 217661-27-3	97%	To inquire	Mon 07 Apr 25
2-(Bromomethyl)-5-fluorobenzonitrile REF: 54-PC500527CAS: 217661-27-3	By hplc: 96.85% (Typical Value in Batch COA)	32.00 €~70.00 €	Tue 08 Apr 25
2-(Bromomethyl)-5-fluorobenzonitrile REF: 10-F229131CAS: 217661-27-3	95.0%	To inquire	Tue 15 Apr 25
2-(Bromomethyl)-5-Fluoro-Benzonitrile REF: 3D-FB83736CAS: 217661-27-3	Min. 95%	- - -	Discontinued product