CAS 21768-44-5

4-Hydroxy-<span class="text-smallcaps">D</span>-allothreonine

Description:

4-Hydroxy-D-allothreonine, with the CAS number 21768-44-5, is an amino acid derivative characterized by the presence of a hydroxyl group (-OH) attached to the fourth carbon of the allothreonine structure. This compound is a stereoisomer of threonine, which is one of the essential amino acids in human nutrition. The presence of the hydroxyl group contributes to its solubility in water and its potential reactivity in biochemical processes. 4-Hydroxy-D-allothreonine may play a role in various metabolic pathways and could be involved in the synthesis of proteins or other biomolecules. Its structural features include a chiral center, which gives rise to its stereochemistry, making it important in biological systems where the orientation of molecules can significantly affect their function. As with many amino acids and their derivatives, it may also exhibit properties such as buffering capacity and the ability to participate in hydrogen bonding, influencing its interactions in biological environments.

Formula: C₄H₉NO₄

InChI: InChI=1S/C4H9NO4/c5-3(4(8)9)2(7)1-6/h2-3,6-7H,1,5H2,(H,8,9)/t2-,3-/m1/s1

InChI key: InChIKey=JBNUARFQOCGDRK-PWNYCUMCSA-N

SMILES: [C@@H]([C@@H](CO)O)(C(O)=O)N

2-Amino-2-deoxy-D-erythronic Acid

Controlled Product

CAS: 21768-44-5

Formula: C₄H₉NO₄

Color and Shape: Neat

Molecular weight: 135.119

Ref: TR-A168155