CAS 2177257-69-9

2-(3-Methoxyphenyl)imidazo[1,5-b]pyridazine-5-carboxylic acid

Description:

2-(3-Methoxyphenyl)imidazo[1,5-b]pyridazine-5-carboxylic acid is a chemical compound characterized by its complex structure, which includes an imidazo[1,5-b]pyridazine core fused with a methoxy-substituted phenyl group and a carboxylic acid functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its heterocyclic nature. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the methoxy group may influence its electronic properties and interactions with biological targets. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in areas like oncology or neurology. The specific characteristics, including melting point, boiling point, and spectral data, would require experimental determination or detailed literature references for precise values. Overall, this compound represents a class of heterocyclic compounds that may exhibit diverse chemical reactivity and biological activity.

Formula: C₁₄H₁₁N₃O₃

InChI: InChI=1S/C14H11N3O3/c1-20-10-4-2-3-9(7-10)11-5-6-12-13(14(18)19)15-8-17(12)16-11/h2-8H,1H3,(H,18,19)

InChI key: InChIKey=NRMKXRDRGPOHFW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(N=C(C=C2)C3=CC(OC)=CC=C3)C=N1

Synonyms:

• Imidazo[1,5-b]pyridazine-5-carboxylic acid, 2-(3-methoxyphenyl)-
• 2-(3-Methoxyphenyl)imidazo[1,5-b]pyridazine-5-carboxylic acid