CymitQuimica logo

CAS 2177263-54-4

:

4H-Pyrazolo[1,5-a][1,4]diazepine-5(6H)-carboxylic acid, 2-amino-7,8-dihydro-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:
4H-Pyrazolo[1,5-a][1,4]diazepine-5(6H)-carboxylic acid, 2-amino-7,8-dihydro-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes both pyrazole and diazepine moieties. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the amino and carboxylic acid functionalities. The ester group suggests it may have lipophilic characteristics, which can influence its solubility and permeability in biological systems. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, particularly those with complex structures that may exhibit varied reactivity.
Formula:C12H20N4O2·ClH
InChI:InChI=1S/C12H20N4O2.ClH/c1-12(2,3)18-11(17)15-5-4-6-16-9(8-15)7-10(13)14-16;/h7H,4-6,8H2,1-3H3,(H2,13,14);1H
InChI key:InChIKey=KGLOOSUQQRVUBV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC=2N(N=C(N)C2)CCC1.Cl
Synonyms:
  • 4H-Pyrazolo[1,5-a][1,4]diazepine-5(6H)-carboxylic acid, 2-amino-7,8-dihydro-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Found 2 products.