
CAS 2177263-95-3
:rel-1,1-Dimethylethyl (5R,9S)-9-(hydroxymethyl)-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
Description:
Rel-1,1-Dimethylethyl (5R,9S)-9-(hydroxymethyl)-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate is a complex organic compound characterized by its spirocyclic structure, which includes a diazaspiro framework. The presence of a hydroxymethyl group and a carboxylate moiety contributes to its reactivity and potential biological activity. The compound features stereocenters, indicated by the (5R,9S) configuration, which suggests specific spatial arrangements of its atoms that can influence its interactions and properties. The oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. This compound may exhibit unique pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Its CAS number, 2177263-95-3, allows for precise identification and reference in chemical databases. Overall, the compound's characteristics suggest potential applications in drug development or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C13H22N2O4
InChI:InChI=1/C13H22N2O4/c1-12(2,3)19-11(18)15-5-4-13(8-15)9(7-16)6-14-10(13)17/h9,16H,4-8H2,1-3H3,(H,14,17)/t9-,13-/s2
InChI key:InChIKey=QEMZDNGDJSMWFR-XLQFWJNKNA-N
SMILES:C(O)[C@@H]1[C@@]2(CN(C(OC(C)(C)C)=O)CC2)C(=O)NC1
Synonyms:- rel-1,1-Dimethylethyl (5R,9S)-9-(hydroxymethyl)-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
- 2,7-Diazaspiro[4.4]nonane-2-carboxylic acid, 9-(hydroxymethyl)-6-oxo-, 1,1-dimethylethyl ester, (5R,9S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.