CAS 2177266-33-8

Methyl 1,4,9-trioxadispiro[4.2.4.2]tetradecane-10-carboxylate

Description:

Methyl 1,4,9-trioxadispiro[4.2.4.2]tetradecane-10-carboxylate is a complex organic compound characterized by its unique molecular structure, which features a dispiro framework and multiple functional groups. The presence of the trioxadispiro moiety indicates that the compound contains three oxygen atoms in its cyclic structure, contributing to its potential reactivity and stability. The carboxylate functional group suggests that it can participate in various chemical reactions, such as esterification or hydrolysis. This compound may exhibit interesting physical properties, including solubility in organic solvents and potential applications in fields like medicinal chemistry or materials science. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Additionally, the compound's safety and handling guidelines would be essential for practical applications, given the potential hazards associated with organic compounds. Overall, Methyl 1,4,9-trioxadispiro[4.2.4.2]tetradecane-10-carboxylate represents a fascinating area of study within organic chemistry.

Formula: C₁₃H₂₀O₅

InChI: InChI=1S/C13H20O5/c1-15-11(14)10-2-3-12(18-10)4-6-13(7-5-12)16-8-9-17-13/h10H,2-9H2,1H3

InChI key: InChIKey=NQDGKQXXCYVOLN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1OC2(CCC3(CC2)OCCO3)CC1

Synonyms:

• Methyl 1,4,9-trioxadispiro[4.2.4.2]tetradecane-10-carboxylate
• 1,4,9-Trioxadispiro[4.2.4.2]tetradecane-10-carboxylic acid, methyl ester

1,4,9-Trioxa-dispiro[4.2.4.2]tetradecane-10-carboxylic acid methyl ester(WX102593)

CAS: 2177266-33-8

Formula: C₁₃H₂₀O₅

Purity: 98%

Molecular weight: 256.2949

Ref: IN-DA01FLE9

Methyl 1,4,9-trioxadispiro[4.2.48.25]tetradecane-10-carboxylate

CAS: 2177266-33-8

Purity: 98%

Molecular weight: 256.2980042

Ref: 10-F615308