CAS 21784-73-6
:4-iodo-2-nitrophenol
Description:
4-Iodo-2-nitrophenol is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) that contributes to its acidic properties, making it a weak acid. The iodine substituent at the para position and the nitro group at the ortho position influence its reactivity and polarity, enhancing its potential as a reagent in various chemical reactions. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic structure. 4-Iodo-2-nitrophenol is often used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, and may also serve as an intermediate in dye production. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C6H4INO3
InChI:InChI=1/C6H4INO3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H
SMILES:c1cc(c(cc1I)N(=O)=O)O
Synonyms:- Phenol, 4-iodo-2-nitro-
- 4-IODO-2-NITROPHENOL
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Iodo-2-nitrophenol
CAS:4-Iodo-2-nitrophenolFormula:C6H4INO3Purity:95%Color and Shape: yellow-green solidMolecular weight:265.01g/mol4-Iodo-2-nitrophenol
CAS:4-Iodo-2-nitrophenol is a halophenol that is used in the production of drugs such as anti-inflammatory agents, antiviral agents, and immunosuppressants. 4-Iodo-2-nitrophenol has been shown to bind to an antigen and stimulate the production of growth factors. 4-Iodo-2-nitrophenol also binds to hif1α, which is a transcription factor that regulates the expression of genes involved in cellular response to low oxygen conditions. Covid -19 pandemic influenza virus uses 4-iodo-2 nitrophenol as a substrate for its replication. This means that this drug can be used as an inhibitor for covid -19 pandemic influenza virus.
Formula:C6H4INO3Purity:Min. 95%Color and Shape:PowderMolecular weight:265.01 g/molRef: 3D-FI70085
Discontinued product



