CAS 21785-09-1

7-methoxyflavanone

Description:

7-Methoxyflavanone is a flavonoid compound characterized by its structure, which includes a flavanone backbone with a methoxy group attached at the 7-position. This compound typically exhibits a yellow to pale yellow color and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, which are common among flavonoids. The presence of the methoxy group can influence its reactivity and interaction with biological systems. 7-Methoxyflavanone is often studied for its potential health benefits and applications in pharmaceuticals and nutraceuticals. Its molecular formula reflects the typical characteristics of flavonoids, contributing to its role in plant pigmentation and UV protection. As with many flavonoids, it may also play a role in the plant's defense mechanisms against pathogens and herbivores.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-18-12-7-8-13-14(17)10-15(19-16(13)9-12)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3

SMILES: COc1ccc2C(=O)CC(c3ccccc3)Oc2c1

Synonyms:

• 7-Methoxyflavone
• 7-methoxy-2-phenyl-4H-chromen-4-one
• 7-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one

7-methoxy-2-phenyl-3,4-dihydro-2H-1-benzopyran-4-one

CAS: 21785-09-1

Formula: C₁₆H₁₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.2806

Ref: IN-DA003NGA

7-Methoxy-2-phenylchroman-4-one

CAS: 21785-09-1

7-Methoxy-2-phenylchroman-4-one

Purity: 98%(GC-MS);RG

Molecular weight: 254.28g/mol

Ref: 54-OR1042754

7-Methoxyflavanone

CAS: 21785-09-1

Formula: C₁₆H₁₄O₃

Purity: (HPLC) ≥ 98.0%

Color and Shape: White to faint yellow crystalline powder

Molecular weight: 254.29

Ref: 7W-GK9960

7-Methoxy-2-phenylchroman-4-one

CAS: 21785-09-1

Purity: 98%(GC-MS);RG

Molecular weight: 254.2850037

Ref: 10-F752661

7-Methoxyflavanone

CAS: 21785-09-1

7-Methoxyflavanone is a bioactive compound, specifically a methoxylated flavanone, which is derived from various plant sources. This compound plays a role in the modulation of several biological pathways due to its structural attributes. As a flavanone, it is known to interact with various cellular mechanisms including enzyme inhibition, receptor binding, and antioxidant activity. These interactions result in diverse pharmacological effects, such as anti-inflammatory and neuroprotective properties.

Formula: C₁₆H₁₄O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 254.28 g/mol

Ref: 3D-FM68084