CAS 21785-09-1
:7-methoxyflavanone
Description:
7-Methoxyflavanone is a flavonoid compound characterized by its structure, which includes a flavanone backbone with a methoxy group attached at the 7-position. This compound typically exhibits a yellow to pale yellow color and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, which are common among flavonoids. The presence of the methoxy group can influence its reactivity and interaction with biological systems. 7-Methoxyflavanone is often studied for its potential health benefits and applications in pharmaceuticals and nutraceuticals. Its molecular formula reflects the typical characteristics of flavonoids, contributing to its role in plant pigmentation and UV protection. As with many flavonoids, it may also play a role in the plant's defense mechanisms against pathogens and herbivores.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-18-12-7-8-13-14(17)10-15(19-16(13)9-12)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3
SMILES:COc1ccc2C(=O)CC(c3ccccc3)Oc2c1
Synonyms:- 7-Methoxyflavone
- 7-methoxy-2-phenyl-4H-chromen-4-one
- 7-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-methoxy-2-phenyl-3,4-dihydro-2H-1-benzopyran-4-one
CAS:Formula:C16H14O3Purity:98%Color and Shape:SolidMolecular weight:254.28067-Methoxy-2-phenylchroman-4-one
CAS:7-Methoxy-2-phenylchroman-4-onePurity:98%(GC-MS);RGMolecular weight:254.28g/mol7-Methoxyflavanone
CAS:Formula:C16H14O3Purity:(HPLC) ≥ 98.0%Color and Shape:White to faint yellow crystalline powderMolecular weight:254.297-Methoxyflavanone
CAS:7-Methoxyflavanone is a bioactive compound, specifically a methoxylated flavanone, which is derived from various plant sources. This compound plays a role in the modulation of several biological pathways due to its structural attributes. As a flavanone, it is known to interact with various cellular mechanisms including enzyme inhibition, receptor binding, and antioxidant activity. These interactions result in diverse pharmacological effects, such as anti-inflammatory and neuroprotective properties.
Formula:C16H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:254.28 g/molRef: 3D-FM68084
Discontinued product




