
CAS 21787-80-4
:N-(4-Chloro-2-methylphenyl)-N′-methylmethanimidamide
Description:
N-(4-Chloro-2-methylphenyl)-N′-methylmethanimidamide, with the CAS number 21787-80-4, is a chemical compound characterized by its unique structure, which includes a chloro-substituted aromatic ring and an amidine functional group. This compound typically exhibits properties associated with both aromatic and amine functionalities, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amidine group. The chloro substituent can influence its reactivity and biological activity, potentially enhancing its interaction with various biological targets. Additionally, the methyl groups contribute to the steric and electronic properties of the molecule, which can affect its overall stability and reactivity. This compound may be of interest in pharmaceutical research and development, particularly in the context of drug design, due to its structural features that could interact with biological systems. However, specific applications and safety profiles would require further investigation and analysis.
Formula:C9H11ClN2
InChI:InChI=1S/C9H11ClN2/c1-7-5-8(10)3-4-9(7)12-6-11-2/h3-6H,1-2H3,(H,11,12)
InChI key:InChIKey=MZCHBOYMVBQHQC-UHFFFAOYSA-N
SMILES:N(=CNC)C1=C(C)C=C(Cl)C=C1
Synonyms:- Methanimidamide, N-(4-chloro-2-methylphenyl)-N′-methyl-
- Formamidine, N′-(4-chloro-o-tolyl)-N-methyl-
- N′-(4-Chloro-o-tolyl)-N-methylformamidine
- N-(4-Chloro-2-methylphenyl)-N′-methylmethanimidamide
- Formamidine, N-(4-chloro-o-tolyl)-N′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Demethylchlordimeform
CAS:Demethylchlordimeform is a biochemiacl.Formula:C9H11ClN2Color and Shape:SolidMolecular weight:182.65
