CAS 217978-01-3

ethyl 2-fluoro-4-hydroxybenzoate

Description:

Ethyl 2-fluoro-4-hydroxybenzoate, with the CAS number 217978-01-3, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid derivative where a hydroxy group (-OH) and a fluoro group (-F) are substituted on the aromatic ring. The presence of the ethyl ester group contributes to its solubility in organic solvents. This compound is characterized by its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The fluorine atom can enhance the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. Additionally, the hydroxy group can participate in hydrogen bonding, influencing the compound's reactivity and interaction with biological targets. Overall, ethyl 2-fluoro-4-hydroxybenzoate exemplifies the importance of functional group positioning in determining the chemical properties and potential applications of aromatic compounds.

Formula: C₉H₉FO₃

InChI: InChI=1/C9H9FO3/c1-2-13-9(12)7-4-3-6(11)5-8(7)10/h3-5,11H,2H2,1H3

SMILES: CCOC(=O)c1ccc(cc1F)O

Synonyms:

• Benzoic Acid, 2-Fluoro-4-Hydroxy-, Ethyl Ester

Ethyl 2-fluoro-4-hydroxybenzoate

CAS: 217978-01-3

Ethyl 2-fluoro-4-hydroxybenzoate

Purity: 95%

Molecular weight: 184.16g/mol

Ref: 54-PC910288