CAS 21815-91-8
:3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride
Description:
3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride, with the CAS number 21815-91-8, is an organic compound characterized by the presence of both a chlorobenzene and a thiophene moiety. This compound features a carboxylic acid chloride functional group, which makes it a reactive acyl chloride. The chlorobenzene ring contributes to its aromatic stability, while the thiophene ring adds heteroatom characteristics, enhancing its reactivity and potential applications in organic synthesis. The presence of the chlorine atom on the benzene ring can influence its electronic properties, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the acid chloride functionality allows for the formation of esters and amides through nucleophilic acyl substitution reactions. This compound is typically handled with care due to its reactivity and potential hazards associated with acid chlorides, including the release of hydrochloric acid upon hydrolysis. Overall, 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride is a valuable building block in synthetic organic chemistry.
Formula:C9H4Cl2OS
InChI:InChI=1/C9H4Cl2OS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H
SMILES:c1ccc2c(c1)c(c(C(=O)Cl)s2)Cl
Synonyms:- 3-Chlorobenzo[b]thiophene-2-carbonyl chloride
- Akos B000002
- Akos Au36-M326
- Akos 92491
- 3-Chlorobenzothiophene-2-Carbonyl Chloride
- Buttpark 30\06-08
- Asischem T31091
- Art-Chem-Bb B000002
- 3-Chloro-1-Benzothiophene-2-Carbonyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Chlorobenzo[b]thiophene-2-carbonyl Chloride
CAS:Formula:C9H4Cl2OSPurity:>97.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:231.093-Chlorobenzo[b]thiophene-2-carbonyl chloride, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H4Cl2OSPurity:95%Color and Shape:Crystals or powder or crystalline powder, Cream to brown to yellow to pale yellowMolecular weight:231.093-Chlorobenzo[b]thiophene-2-carbonyl chloride
CAS:Formula:C9H4Cl2OSPurity:98%Color and Shape:SolidMolecular weight:231.09853-Chlorobenzo[b]thiophene-2-carbonyl chloride
CAS:3-Chlorobenzo[b]thiophene-2-carbonyl chloridePurity:98%Molecular weight:231.09846g/mol3-Chlorobenzothiophene-2-carbonyl chloride
CAS:Formula:C9H4Cl2OSPurity:98%Color and Shape:SolidMolecular weight:231.09




