
CAS 21816-42-2
:Pyridine, 2,5-dimethyl-4-nitro-, 1-oxide
Description:
Pyridine, 2,5-dimethyl-4-nitro-, 1-oxide, also known by its CAS number 21816-42-2, is a heterocyclic organic compound characterized by a pyridine ring with specific substituents. This compound features a nitro group (-NO2) and two methyl groups (-CH3) attached to the pyridine ring, which significantly influence its chemical properties and reactivity. The presence of the nitro group typically enhances the compound's electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methyl groups can affect the steric and electronic properties of the molecule, influencing its solubility and interaction with other substances. Pyridine derivatives are often used in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound may exhibit moderate toxicity, and appropriate safety measures should be taken when handling it. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample.
Formula:C7H8N2O3
InChI:InChI=1S/C7H8N2O3/c1-5-4-8(10)6(2)3-7(5)9(11)12/h3-4H,1-2H3
InChI key:InChIKey=GVGSFHVUBRWBJT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(C)=CN(=O)=C(C)C1
Synonyms:- 2,5-Dimethyl-4-nitro-1-oxidopyridin-1-ium
- 2,5-Dimethyl-4-nitropyridine N-oxide
- Pyridine, 2,5-dimethyl-4-nitro-, 1-oxide
- 2,5-Lutidine, 4-nitro-, 1-oxide
- 2,5-Dimethyl-4-nitropyridine 1-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pyridine,2,5-dimethyl-4-nitro-, 1-oxide
CAS:Formula:C7H8N2O3Purity:95%Color and Shape:SolidMolecular weight:168.152,5-dimethyl-4-nitropyridin-1-ium-1-olate
CAS:<p>2,5-Dimethyl-4-nitropyridin-1-ium-1-olate (DMNPE) is a ligand that binds to the estrogen receptor. DMNPE has been shown to be an effective chemotherapeutic agent for cancer cells in the mononuclear cell line Mcf7. DMNPE also inhibits tumor growth and metastasis in a murine leukemia model. It has been shown to bind to the nongenomic binding site of the estrogen receptor and act as an antagonist of estradiol by competing with estradiol for binding sites on the estrogen receptor. DMNPE is able to bind to two different receptors, which may account for its observed anti-tumor effects. It has been shown to inhibit protein synthesis by methylating proteins and inhibiting DNA synthesis through inhibition of ribonucleotide reductase activity.</p>Formula:C7H8N2O3Purity:Min. 95%Molecular weight:168.15 g/mol

