CAS 21824-10-2
:fluoro(nitro)methane
Description:
Fluoro(nitro)methane, with the CAS number 21824-10-2, is a chemical compound characterized by the presence of both fluorine and nitro functional groups attached to a methane backbone. This compound typically appears as a colorless gas or liquid, depending on the temperature and pressure conditions. It is known for its relatively low boiling point and moderate volatility. The presence of the fluorine atom contributes to its chemical stability and potential reactivity, while the nitro group can impart unique properties, such as increased polarity and potential for further chemical transformations. Fluoro(nitro)methane is often studied for its applications in organic synthesis and as a potential intermediate in the production of more complex fluorinated compounds. Additionally, it may exhibit specific environmental and health considerations, necessitating careful handling and usage in laboratory or industrial settings. Overall, fluoro(nitro)methane represents an interesting compound within the realm of organofluorine chemistry, with implications for both research and practical applications.
Formula:CH2FNO2
InChI:InChI=1/CH2FNO2/c2-1-3(4)5/h1H2
SMILES:C(F)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.