CAS 2183-66-6

4-Amino-2-methylthiopyrimidine

Description:

4-Amino-2-methylthiopyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with an amino group and a methylthio group. Its molecular structure features a six-membered ring containing two nitrogen atoms at positions 1 and 3, which is typical of pyrimidines. The presence of the amino group at position 4 contributes to its basicity and potential reactivity, while the methylthio group at position 2 introduces sulfur into the structure, influencing its chemical properties and interactions. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents. It is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in the synthesis of pharmaceuticals. The compound's reactivity can be attributed to the functional groups present, allowing for various chemical transformations. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₇N₃S

InChI: InChI=1/C5H7N3S/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3,(H2,6,7,8)

SMILES: CSc1nccc(=N)[nH]1

Synonyms:

• 2-(Methylthio)pyrimidin-4-amine
• 2-(Methylsulfanyl)Pyrimidin-4-Amine
• 2-Methylthio-4-Aminopyrimidine

2-(Methylthio)pyrimidin-4-amine

CAS: 2183-66-6

Formula: C₅H₇N₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 141.1942

Ref: IN-DA006Z4K

4-Amino-2-(methylthio)pyrimidine

CAS: 2183-66-6

4-Amino-2-(methylthio)pyrimidine

Formula: C₅H₇N₃S

Purity: ≥95%

Color and Shape: red solid

Molecular weight: 141.19g/mol

Ref: 54-OR59797

4-Amino-2-methylsulfanylpyrimidine

CAS: 2183-66-6

Formula: C₅H₇N₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.19

Ref: 10-F046910