CAS 218301-22-5

2-Fluoro-5-formylbenzonitrile

Description:

2-Fluoro-5-formylbenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom, a formyl group (-CHO), and a nitrile group (-C≡N). The presence of the fluorine atom typically enhances the compound's reactivity and can influence its electronic properties, making it useful in various chemical applications. The formyl group introduces a reactive aldehyde functionality, while the nitrile group contributes to the compound's polarity and potential for further chemical transformations. This compound is generally used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its unique combination of functional groups allows for diverse reactivity, including nucleophilic additions and condensation reactions. Additionally, the compound's physical properties, such as solubility and melting point, can be influenced by the presence of the fluorine atom and the overall molecular structure. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and reactivity.

Formula: C₈H₄FNO

InChI: InChI=1S/C8H4FNO/c9-8-2-1-6(5-11)3-7(8)4-10/h1-3,5H

SMILES: c1cc(c(cc1C=O)C#N)F

Synonyms:

• 3-Cyano-4-fluorobenzaldehyde
• 2-Fluoro-5-Formyl-benzonitrile
• Benzonitrile, 2-fluoro-5-formyl-
• 4-Fluoro-3-cyanobenzaldehyde

2-Fluoro-5-formylbenzonitrile

CAS: 218301-22-5

Formula: C₈H₄FNO

Purity: >98.0%(GC)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 149.12

Ref: 3B-C2692

4-Fluoro-3-cyanobenzaldehyde

CAS: 218301-22-5

Formula: C₈H₄FNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 149.1219

Ref: IN-DA003HA3

2-Fluoro-5-formylbenzonitrile

CAS: 218301-22-5

2-Fluoro-5-formylbenzonitrile

Formula: C₈H₄FNO

Purity: 97%

Color and Shape: off white solid

Molecular weight: 149.12186g/mol

Ref: 54-PC8847

Olaparib Impurity 60

CAS: 218301-22-5

Formula: C₈H₄FNO

Molecular weight: 149.12

Ref: 4Z-O-032065

3-Cyano-4-fluorobenzaldehyde

CAS: 218301-22-5

Formula: C₈H₄FNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 149.124

Ref: 10-F023328

3-Cyano-4-fluorobenzaldehyde

Controlled Product

CAS: 218301-22-5

Formula: C₈H₄FNO

Color and Shape: Neat

Molecular weight: 149.12

Ref: TR-C987515

Olaparib Impurity 60

CAS: 218301-22-5

Formula: C₈H₄FNO

Molecular weight: 149.12

Ref: ST-EA-CP-O6046

2-Fluoro-5-formylbenzonitrile

CAS: 218301-22-5

Intermediate in the synthesis of olaparib (AZD2281)

Formula: C₈H₄FNO

Purity: 90%

Color and Shape: Powder

Molecular weight: 149.12 g/mol

Ref: 3D-FF66937