CymitQuimica logo

CAS 218301-62-3

:

Morpholine, 4-(3-fluoro-4-nitrophenyl)-

Description:
Morpholine, 4-(3-fluoro-4-nitrophenyl)-, with the CAS number 218301-62-3, is a chemical compound that features a morpholine ring substituted with a 3-fluoro-4-nitrophenyl group. Morpholine is a six-membered heterocyclic compound containing one oxygen and one nitrogen atom, which contributes to its basic properties. The presence of the nitro group introduces significant polarity and can enhance the compound's reactivity, while the fluorine atom can influence its electronic properties and lipophilicity. This compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the morpholine moiety. Its potential applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many nitro-substituted compounds, it may also exhibit specific biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.
Formula:C10H11FN2O3
InChI:InChI=1S/C10H11FN2O3/c11-9-7-8(1-2-10(9)13(14)15)12-3-5-16-6-4-12/h1-2,7H,3-6H2
InChI key:OQVXZXWWCKAODG-UHFFFAOYSA-N
SMILES:C1COCCN1C2=CC(=C(C=C2)[N+](=O)[O-])F
Found 4 products.