
CAS 2183470-13-3
:3-Pyridinesulfonamide, N-[3-[2-(2-amino-5-pyrimidinyl)ethynyl]-2,4-difluorophenyl]-5-chloro-2-methoxy-, acetate (1:1)
Description:
3-Pyridinesulfonamide, N-[3-[2-(2-amino-5-pyrimidinyl)ethynyl]-2,4-difluorophenyl]-5-chloro-2-methoxy-, acetate (1:1) is a complex organic compound characterized by its unique structural features, which include a pyridine sulfonamide moiety and a substituted phenyl group. The presence of a difluorophenyl group and a pyrimidine derivative suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The acetate component indicates that the compound may exist in a salt form, which can influence its solubility and stability. This compound likely exhibits specific biological activities due to its functional groups, which may interact with various biological targets. Additionally, the presence of chlorine and methoxy groups can affect its electronic properties and reactivity. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research, particularly in the fields of drug discovery and development.
Formula:C18H12ClF2N5O3S·C2H4O2
InChI:InChI=1S/C18H12ClF2N5O3S.C2H4O2/c1-29-17-15(6-11(19)9-23-17)30(27,28)26-14-5-4-13(20)12(16(14)21)3-2-10-7-24-18(22)25-8-10;1-2(3)4/h4-9,26H,1H3,(H2,22,24,25);1H3,(H,3,4)
InChI key:InChIKey=QNHLMBSUYPVOLX-UHFFFAOYSA-N
SMILES:S(NC1=C(F)C(C#CC=2C=NC(N)=NC2)=C(F)C=C1)(=O)(=O)C3=C(OC)N=CC(Cl)=C3.C(C)(O)=O
Synonyms:- 3-Pyridinesulfonamide, N-[3-[2-(2-amino-5-pyrimidinyl)ethynyl]-2,4-difluorophenyl]-5-chloro-2-methoxy-, acetate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
GCN2iB acetate
CAS:GCN2iB inhibits GCN2, sensitizing certain cancer cells to L-asparaginase treatment.Formula:C20H16ClF2N5O5SColor and Shape:SolidMolecular weight:511.8848
