CAS 2185-16-2
:N5-Acetyl-L-ornithine
Description:
N5-Acetyl-L-ornithine, with the CAS number 2185-16-2, is an amino acid derivative that plays a role in various biochemical processes. It is a modified form of the amino acid L-ornithine, where an acetyl group is attached to the nitrogen atom at the fifth position. This modification can influence its solubility, stability, and biological activity. N5-Acetyl-L-ornithine is often studied in the context of metabolic pathways, particularly those involving the urea cycle and arginine metabolism. It may also have implications in the synthesis of polyamines and other nitrogen-containing compounds. The compound is typically characterized by its white crystalline appearance and is soluble in water and organic solvents, making it useful in various laboratory applications. Additionally, it may exhibit specific interactions with enzymes and receptors, contributing to its potential therapeutic applications. As with many amino acid derivatives, its properties can be influenced by pH and temperature, which are important considerations in experimental settings.
Formula:C7H14N2O3
InChI:InChI=1S/C7H14N2O3/c1-5(10)9-4-2-3-6(8)7(11)12/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1
InChI key:InChIKey=SRXKAYJJGAAOBP-LURJTMIESA-N
SMILES:C(CCNC(C)=O)[C@@H](C(O)=O)N
Synonyms:- (2S)-2-Amino-5-acetamidopentanoic acid
- <span class="text-smallcaps">L</span>-Ornithine, N<sup>5</sup>-acetyl-
- N<sup>5</sup>-Acetyl-<span class="text-smallcaps">L</span>-ornithine
- N<sup>5</sup>-Acetylornithine
- N<sup>δ</sup>-Acetyl-<span class="text-smallcaps">L</span>-ornithine
- Ornithine, N<sup>5</sup>-acetyl-
- Ornithine, N<sup>5</sup>-acetyl-, <span class="text-smallcaps">L</span>-
- ornithine, N~2~-acetyl-
- δ-Acetyl-<span class="text-smallcaps">L</span>-ornithine
- ω-N-Acetylornithine
- Ornithine, N5-acetyl-
- N5-Acetyl-L-ornithine
- L-Ornithine, N5-acetyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-Acetylornithine
CAS:Acyclic amides (including acyclic carbamates) and their derivatives and salts thereof, nesoiFormula:C7H14N2O3Color and Shape:White PowderMolecular weight:174.10044(S)-5-Acetamido-2-aminopentanoic acid
CAS:(S)-5-Acetamido-2-aminopentanoic acidPurity:97%Molecular weight:174.20g/molN(δ)-acetylornithine
CAS:Formula:C7H14N2O3Purity:≥ 98.0%Color and Shape:White or off-white powderMolecular weight:174.20N(δ)-acetylornithine
CAS:N(delta)-acetylornithine is a non-protein amino acid and a defence-related plant metabolite, primarily found in Arabidopsis. The inclusion of N(delta)-acetylornithine in feed can reduce the reproduction of Myzus persicae and exhibits certain toxic properties.Formula:C7H14N2O3Purity:97.33%Color and Shape:SolidMolecular weight:174.22-Acetamido-5-aminopentanoic acid
CAS:2-Acetamido-5-aminopentanoic acid (2AAP) is a potential biomarker for obesity. 2AAP is synthesized from the amino acid glutamate by a synthetase that is active in adipose tissue and has a high level of aminotransferase activity. This molecule can be an inhibitor of the enzyme aconitase, which plays an important role in the citric acid cycle. This inhibition could lead to changes in body mass index (BMI). The wild-type strain of Escherichia coli and Salmonella typhimurium have been shown to produce 2AAP with x-ray diffraction data. Preparative hplc was used to isolate this compound from urine samples.Formula:C7H14N2O3Purity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:174.2 g/mol








