CAS 21852-32-4: 4-(bromomethyl)-1,2-dimethoxybenzene

Description:4-(Bromomethyl)-1,2-dimethoxybenzene, with the CAS number 21852-32-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methoxy groups and a bromomethyl group. The presence of the bromomethyl group introduces a reactive site, making it useful in various chemical reactions, such as nucleophilic substitutions. The methoxy groups contribute to the compound's electron-donating properties, influencing its reactivity and solubility in organic solvents. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's properties, such as boiling point, melting point, and density, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and its potential reactivity.

Formula:C₉H₁₁BrO₂

InChI:InChI=1/C9H11BrO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,6H2,1-2H3

Synonyms:
3,4-Dimethoxybenzyl Bromide

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-(Bromomethyl)-1,2-dimethoxybenzene REF: IN-DA00385XCAS: 21852-32-4	97%	To inquire	Mon 14 Apr 25
4-(Bromomethyl)-1,2-dimethoxybenzene REF: 54-OR72146CAS: 21852-32-4	97%	99.00 €~1,317.00 €	Mon 21 Apr 25
Pinaverium Bromide Impurity 17 REF: 4Z-P-7024CAS: 21852-32-4	- - -	To inquire	Mon 21 Apr 25
4-(Bromomethyl)-1,2-dimethoxybenzene REF: 10-F079648CAS: 21852-32-4	95.0%	To inquire	Thu 24 Apr 25
3,4-Dimethoxybenzyl bromide REF: 3D-FD22198CAS: 21852-32-4	Min. 95 Area-%	157.00 €~972.00 €	Fri 25 Apr 25