CAS 21852-32-4

4-(bromomethyl)-1,2-dimethoxybenzene

Description:

4-(Bromomethyl)-1,2-dimethoxybenzene, with the CAS number 21852-32-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methoxy groups and a bromomethyl group. The presence of the bromomethyl group introduces a reactive site, making it useful in various chemical reactions, such as nucleophilic substitutions. The methoxy groups contribute to the compound's electron-donating properties, influencing its reactivity and solubility in organic solvents. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's properties, such as boiling point, melting point, and density, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and its potential reactivity.

Formula: C₉H₁₁BrO₂

InChI: InChI=1/C9H11BrO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,6H2,1-2H3

SMILES: COc1ccc(cc1OC)CBr

Synonyms:

• 3,4-Dimethoxybenzyl Bromide

4-(Bromomethyl)-1,2-dimethoxybenzene

CAS: 21852-32-4

Formula: C₉H₁₁BrO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 231.0864

Ref: IN-DA00385X

4-(Bromomethyl)-1,2-dimethoxybenzene

CAS: 21852-32-4

4-(Bromomethyl)-1,2-dimethoxybenzene

Purity: 97% (stabilized with Cu+MgO)

Molecular weight: 231.09g/mol

Ref: 54-OR72146

Pinaverium Bromide Impurity 17

CAS: 21852-32-4

Formula: C₉H₁₁BrO₂

Molecular weight: 231.09

Ref: 4Z-P-7024

3,4-Dimethoxybenzyl bromide

CAS: 21852-32-4

3,4-Dimethoxybenzyl bromide is an organic compound that is used in the synthesis of isoquinoline alkaloids. This chemical has been found to have anticancer activity against human colon cancer cells (HCT116) and low energy properties. The asymmetric synthesis of 3,4-dimethoxybenzyl bromide can be achieved through a Grignard reaction with phenylmagnesium bromide. A linker can be used to attach 3,4-dimethoxybenzyl bromide to other chemicals such as biphenyls or amines.

Formula: C₉H₁₁BrO₂

Purity: Min. 95 Area-%

Color and Shape: White Powder

Molecular weight: 231.09 g/mol

Ref: 3D-FD22198

4-(Bromomethyl)-1,2-dimethoxybenzene

CAS: 21852-32-4

Formula: C₉H₁₁BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 231.089

Ref: 10-F079648

Pinaverium Bromide Impurity 17

CAS: 21852-32-4

Formula: C₉H₁₁BrO₂

Molecular weight: 231.09

Ref: ST-EA-CP-P35022