CAS 21857-32-9
:1-(bromomethyl)-4-methylcyclohexane
Description:
1-(Bromomethyl)-4-methylcyclohexane is an organic compound characterized by a cyclohexane ring with a bromomethyl group and a methyl group attached to it. The presence of the bromomethyl group introduces a halogen, which can enhance the compound's reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. The methyl group contributes to the compound's overall hydrophobic character and can influence its physical properties, such as boiling and melting points. This compound is typically a colorless to pale yellow liquid at room temperature and may have a distinctive odor. Its molecular structure allows for potential stereoisomerism due to the cyclohexane ring's conformational flexibility. 1-(Bromomethyl)-4-methylcyclohexane is often utilized in organic synthesis and may serve as an intermediate in the production of more complex molecules. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous and may pose environmental risks.
Formula:C8H15Br
InChI:InChI=1/C8H15Br/c1-7-2-4-8(6-9)5-3-7/h7-8H,2-6H2,1H3
SMILES:CC1CCC(CC1)CBr
Synonyms:- Cyclohexane, 1-(Bromomethyl)-4-Methyl-
- 1-(Bromomethyl)-4-methylcyclohexane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(Bromomethyl)-4-methylcyclohexane
CAS:1-(Bromomethyl)-4-methylcyclohexane is a chemical compound that has two stereoisomers. The equilibrium between the two conformers is influenced by temperature and pressure, but no experimental data are available to determine the rate constant of this process. The conformation of the molecule is determined by both steric and electronic effects. There are two conformers of 1-(bromomethyl)-4-methylcyclohexane, which are both axial, but have different degrees of planarity. This compound can be used as a reagent in spectroscopy experiments because it has two distinct absorption bands in the infrared spectrum. One conformer has a radical character while the other does not.
Formula:C8H15BrPurity:Min. 95%Molecular weight:191.11 g/mol


