CAS 218594-15-1

tert-butyl (6-bromopyridin-3-yl)carbamate

Description:

Tert-butyl (6-bromopyridin-3-yl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonyl compound. This substance features a tert-butyl group, providing steric hindrance and enhancing its lipophilicity, which can influence its solubility and reactivity. The presence of the 6-bromopyridin-3-yl moiety introduces a heterocyclic aromatic system, contributing to the compound's potential biological activity and reactivity due to the electron-withdrawing nature of the bromine atom. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, where it may serve as an intermediate or a building block. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₃BrN₂O₂

InChI: InChI=1/C10H13BrN2O2/c1-10(2,3)15-9(14)13-7-4-5-8(11)12-6-7/h4-6H,1-3H3,(H,13,14)

SMILES: CC(C)(C)OC(=Nc1ccc(Br)nc1)O

Synonyms:

• tert-butyl N-(6-bromopyridin-3-yl)carbamate

2-Bromo-5-Boc-aminopyridine

CAS: 218594-15-1

Formula: C₁₀H₁₃BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 273.1264

Ref: IN-DA0037TB

5-Amino-2-bromopyridine, 5-BOC protected

CAS: 218594-15-1

5-Amino-2-bromopyridine, 5-BOC protected

Formula: C₁₀H₁₃BrN₂O₂

Purity: 95%

Color and Shape: white to off-white solid

Molecular weight: 273.13g/mol

Ref: 54-OR5734

tert-Butyl 6-Bromopyridin-3-ylcarbamate

CAS: 218594-15-1

Formula: C₁₀H₁₃BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 273.13

Ref: 10-F064823